C9H10N2S — CID 84656679
6-ethylthieno[2,3-b]pyridin-4-amine (PubChem CID 84656679) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 6-ethylthieno[2,3-b]pyridin-4-amine.
| Compound Name | 6-ethylthieno[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 84656679 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 6-ethylthieno[2,3-b]pyridin-4-amine |
| SMILES | CCc1cc(N)c2ccsc2n1 |
| InChI | InChI=1S/C9H10N2S/c1-2-6-5-8(10)7-3-4-12-9(7)11-6/h3-5H,2H2,1H3,(H2,10,11) |
| InChIKey | LRINDDSFAYQPGH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |