C11H15N3S2 — CID 103727732
2-pentan-2-ylsulfanylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103727732) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 2-pentan-2-ylsulfanylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-pentan-2-ylsulfanylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103727732 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-pentan-2-ylsulfanylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCC(C)Sc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C11H15N3S2/c1-3-4-7(2)16-11-13-9(12)8-5-6-15-10(8)14-11/h5-7H,3-4H2,1-2H3,(H2,12,13,14) |
| InChIKey | VBSCESHNSIFRGK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |