About 4-chloro-5-fluorothieno[2,3-b]pyridine
4-chloro-5-fluorothieno[2,3-b]pyridine (PubChem CID 148533768) has the molecular formula C7H3ClFNS
and a molecular weight of 187.63 g/mol. Its IUPAC name is 4-chloro-5-fluorothieno[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-chloro-5-fluorothieno[2,3-b]pyridine |
|---|
| PubChem CID | 148533768 |
|---|
| Molecular Formula | C7H3ClFNS |
|---|
| Molecular Weight | 187.63 g/mol |
|---|
| Exact Mass | 186.97 |
|---|
| IUPAC Name | 4-chloro-5-fluorothieno[2,3-b]pyridine |
|---|
| SMILES | Fc1cnc2sccc2c1Cl |
|---|
| InChI | InChI=1S/C7H3ClFNS/c8-6-4-1-2-11-7(4)10-3-5(6)9/h1-3H |
|---|
| InChIKey | MQUCDAGVKHVRNG-UHFFFAOYSA-N |
|---|
| XLogP | 3.09 |
|---|
| TPSA | 12.89 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-5-fluorothieno[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-fluorothieno[2,3-b]pyridine?
The IUPAC name of 4-chloro-5-fluorothieno[2,3-b]pyridine (CID 148533768) is 4-chloro-5-fluorothieno[2,3-b]pyridine.
What is the SMILES notation for 4-chloro-5-fluorothieno[2,3-b]pyridine?
The canonical SMILES for 4-chloro-5-fluorothieno[2,3-b]pyridine is Fc1cnc2sccc2c1Cl.
What is the InChIKey of 4-chloro-5-fluorothieno[2,3-b]pyridine?
The InChIKey is MQUCDAGVKHVRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClFNS/c8-6-4-1-2-11-7(4)10-3-5(6)9/h1-3H.
What are the key properties of 4-chloro-5-fluorothieno[2,3-b]pyridine?
4-chloro-5-fluorothieno[2,3-b]pyridine has a molecular weight of 187.63 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-fluorothieno[2,3-b]pyridine is sourced from PubChem (CID 148533768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).