C7H3ClFNS — CID 148533768
4-chloro-5-fluorothieno[2,3-b]pyridine (PubChem CID 148533768) has the molecular formula C7H3ClFNS and a molecular weight of 187.63 g/mol. Its IUPAC name is 4-chloro-5-fluorothieno[2,3-b]pyridine.
| Compound Name | 4-chloro-5-fluorothieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 148533768 |
| Molecular Formula | C7H3ClFNS |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 4-chloro-5-fluorothieno[2,3-b]pyridine |
| SMILES | Fc1cnc2sccc2c1Cl |
| InChI | InChI=1S/C7H3ClFNS/c8-6-4-1-2-11-7(4)10-3-5(6)9/h1-3H |
| InChIKey | MQUCDAGVKHVRNG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |