C14H7Cl4F2N2O2PS2 — CID 159478401
4-chloro-5-fluorothieno[2,3-b]pyridine;5-fluoro-7H-thieno[2,3-b]pyridin-4-one;phosphoryl trichloride (PubChem CID 159478401) has the molecular formula C14H7Cl4F2N2O2PS2 and a molecular weight of 510.14 g/mol. Its IUPAC name is 4-chloro-5-fluorothieno[2,3-b]pyridine;5-fluoro-7H-thieno[2,3-b]pyridin-4-one;phosphoryl trichloride.
| Compound Name | 4-chloro-5-fluorothieno[2,3-b]pyridine;5-fluoro-7H-thieno[2,3-b]pyridin-4-one;phosphoryl trichloride |
|---|---|
| PubChem CID | 159478401 |
| Molecular Formula | C14H7Cl4F2N2O2PS2 |
| Molecular Weight | 510.14 g/mol |
| Exact Mass | 507.84 |
| IUPAC Name | 4-chloro-5-fluorothieno[2,3-b]pyridine;5-fluoro-7H-thieno[2,3-b]pyridin-4-one;phosphoryl trichloride |
| SMILES | Fc1cnc2sccc2c1Cl.O=P(Cl)(Cl)Cl.O=c1c(F)c[nH]c2sccc12 |
| InChI | InChI=1S/C7H3ClFNS.C7H4FNOS.Cl3OP/c8-6-4-1-2-11-7(4)10-3-5(6)9;8-5-3-9-7-4(6(5)10)1-2-11-7;1-5(2,3)4/h1-3H;1-3H,(H,9,10); |
| InChIKey | LWRGXJSXOFPXPI-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.14 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|