C7H7N3S — CID 14207945
thieno[2,3-b]pyridine-4,5-diamine (PubChem CID 14207945) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is thieno[2,3-b]pyridine-4,5-diamine.
| Compound Name | thieno[2,3-b]pyridine-4,5-diamine |
|---|---|
| PubChem CID | 14207945 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | thieno[2,3-b]pyridine-4,5-diamine |
| SMILES | Nc1cnc2sccc2c1N |
| InChI | InChI=1S/C7H7N3S/c8-5-3-10-7-4(6(5)9)1-2-11-7/h1-3H,8H2,(H2,9,10) |
| InChIKey | ILHBCSHYDFMFRN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |