C12H7ClFN3S — CID 2538570
N-(3-chloro-2-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 2538570) has the molecular formula C12H7ClFN3S and a molecular weight of 279.73 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2538570 |
| Molecular Formula | C12H7ClFN3S |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Fc1c(Cl)cccc1Nc1ncnc2sccc12 |
| InChI | InChI=1S/C12H7ClFN3S/c13-8-2-1-3-9(10(8)14)17-11-7-4-5-18-12(7)16-6-15-11/h1-6H,(H,15,16,17) |
| InChIKey | JEKPUGGFHXHDJC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |