C14H13N3S — CID 8934299
N-(2,3-dimethylphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 8934299) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,3-dimethylphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 8934299 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(2,3-dimethylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cccc(Nc2ncnc3sccc23)c1C |
| InChI | InChI=1S/C14H13N3S/c1-9-4-3-5-12(10(9)2)17-13-11-6-7-18-14(11)16-8-15-13/h3-8H,1-2H3,(H,15,16,17) |
| InChIKey | KGHSIYXIFYJADT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |