C8H4BrNO2S — CID 106886413
2-(3-bromofuran-2-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 106886413) has the molecular formula C8H4BrNO2S and a molecular weight of 258.10 g/mol. Its IUPAC name is 2-(3-bromofuran-2-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(3-bromofuran-2-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 106886413 |
| Molecular Formula | C8H4BrNO2S |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 256.91 |
| IUPAC Name | 2-(3-bromofuran-2-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2occc2Br)s1 |
| InChI | InChI=1S/C8H4BrNO2S/c9-6-1-2-12-7(6)8-10-3-5(4-11)13-8/h1-4H |
| InChIKey | QELQQLCAMAESKJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|