C9H7N3OS — CID 130941438
2-(4-methylpyrimidin-5-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 130941438) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is 2-(4-methylpyrimidin-5-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(4-methylpyrimidin-5-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 130941438 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 2-(4-methylpyrimidin-5-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1ncncc1-c1ncc(C=O)s1 |
| InChI | InChI=1S/C9H7N3OS/c1-6-8(3-10-5-12-6)9-11-2-7(4-13)14-9/h2-5H,1H3 |
| InChIKey | XPQRAUKULYDNBF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|