C11H6Cl2OS — CID 125491605
4-(2,5-dichlorothiophen-3-yl)benzaldehyde (PubChem CID 125491605) has the molecular formula C11H6Cl2OS and a molecular weight of 257.14 g/mol. Its IUPAC name is 4-(2,5-dichlorothiophen-3-yl)benzaldehyde.
| Compound Name | 4-(2,5-dichlorothiophen-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 125491605 |
| Molecular Formula | C11H6Cl2OS |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 4-(2,5-dichlorothiophen-3-yl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C11H6Cl2OS/c12-10-5-9(11(13)15-10)8-3-1-7(6-14)2-4-8/h1-6H |
| InChIKey | RWFMPYMQXAVLBN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|