C28H31N3O5 — CID 67018896
2-[(1S)-5-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid (PubChem CID 67018896) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid.
| Compound Name | 2-[(1S)-5-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid |
|---|---|
| PubChem CID | 67018896 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[(1S)-5-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)[C@@H]1CCc2cc(OCCCNCc3nccc(-c4ccc5c(c4)OCO5)n3)ccc21 |
| InChI | InChI=1S/C28H31N3O5/c1-2-21(28(32)33)23-7-4-18-14-20(6-8-22(18)23)34-13-3-11-29-16-27-30-12-10-24(31-27)19-5-9-25-26(15-19)36-17-35-25/h5-6,8-10,12,14-15,21,23,29H,2-4,7,11,13,16-17H2,1H3,(H,32,33)/t21?,23-/m0/s1 |
| InChIKey | OGKNZMIZCXFPNS-YANBTOMASA-N |
| XLogP | 4.57 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|