methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate

C15H20O3 — CID 23529443

IUPACmethyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate
SMILESCCC(C(=O)OC)C1CCc2cc(OC)ccc21
InChIInChI=1S/C15H20O3/c1-4-12(15(16)18-3)14-7-5-10-9-11(17-2)6-8-13(10)14/h6,8-9,12,14H,4-5,7H2,1-3H3
InChIKeyLRKHKEBXULVFCW-UHFFFAOYSA-N
MW248.32 g/mol
LogP2.92
Rot. Bonds4

About methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate

methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate (PubChem CID 23529443) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate.

Molecular Properties

Compound Namemethyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate
PubChem CID23529443
Molecular FormulaC15H20O3
Molecular Weight248.32 g/mol
Exact Mass248.14
IUPAC Namemethyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate
SMILESCCC(C(=O)OC)C1CCc2cc(OC)ccc21
InChIInChI=1S/C15H20O3/c1-4-12(15(16)18-3)14-7-5-10-9-11(17-2)6-8-13(10)14/h6,8-9,12,14H,4-5,7H2,1-3H3
InChIKeyLRKHKEBXULVFCW-UHFFFAOYSA-N
XLogP2.92
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.32
LogP ≤ 52.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate?
The IUPAC name of methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate (CID 23529443) is methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate.
What is the SMILES notation for methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate?
The canonical SMILES for methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate is CCC(C(=O)OC)C1CCc2cc(OC)ccc21.
What is the InChIKey of methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate?
The InChIKey is LRKHKEBXULVFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-4-12(15(16)18-3)14-7-5-10-9-11(17-2)6-8-13(10)14/h6,8-9,12,14H,4-5,7H2,1-3H3.
What are the key properties of methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate?
methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate has a molecular weight of 248.32 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate is sourced from PubChem (CID 23529443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).