C15H20O3 — CID 23529443
methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate (PubChem CID 23529443) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate.
| Compound Name | methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate |
|---|---|
| PubChem CID | 23529443 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | methyl 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)butanoate |
| SMILES | CCC(C(=O)OC)C1CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C15H20O3/c1-4-12(15(16)18-3)14-7-5-10-9-11(17-2)6-8-13(10)14/h6,8-9,12,14H,4-5,7H2,1-3H3 |
| InChIKey | LRKHKEBXULVFCW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |