C22H21ClN2O2 — CID 7920218
2-(4-chlorophenyl)-6-methyl-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide (PubChem CID 7920218) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-methyl-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-6-methyl-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 7920218 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-(4-chlorophenyl)-6-methyl-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(Cl)cc3)cc(C(=O)NC[C@@H]3CCCO3)c2c1 |
| InChI | InChI=1S/C22H21ClN2O2/c1-14-4-9-20-18(11-14)19(22(26)24-13-17-3-2-10-27-17)12-21(25-20)15-5-7-16(23)8-6-15/h4-9,11-12,17H,2-3,10,13H2,1H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | JTZJNLDEMYXZEK-KRWDZBQOSA-N |
| XLogP | 4.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |