C21H21ClN2O2S — CID 40719728
6-chloro-2-(5-ethylthiophen-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide (PubChem CID 40719728) has the molecular formula C21H21ClN2O2S and a molecular weight of 400.93 g/mol. Its IUPAC name is 6-chloro-2-(5-ethylthiophen-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide.
| Compound Name | 6-chloro-2-(5-ethylthiophen-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 40719728 |
| Molecular Formula | C21H21ClN2O2S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 6-chloro-2-(5-ethylthiophen-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]quinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)NC[C@@H]3CCCO3)c3cc(Cl)ccc3n2)s1 |
| InChI | InChI=1S/C21H21ClN2O2S/c1-2-15-6-8-20(27-15)19-11-17(16-10-13(22)5-7-18(16)24-19)21(25)23-12-14-4-3-9-26-14/h5-8,10-11,14H,2-4,9,12H2,1H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | MMYBLOYWNCXNMS-AWEZNQCLSA-N |
| XLogP | 5.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |