C22H15Cl2N3O — CID 3649172
2-(3,4-dichlorophenyl)-N-(5-methyl-2-pyridinyl)quinoline-4-carboxamide (PubChem CID 3649172) has the molecular formula C22H15Cl2N3O and a molecular weight of 408.29 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(5-methyl-2-pyridinyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(5-methyl-2-pyridinyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3649172 |
| Molecular Formula | C22H15Cl2N3O |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(5-methyl-2-pyridinyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccc(Cl)c(Cl)c3)nc3ccccc23)nc1 |
| InChI | InChI=1S/C22H15Cl2N3O/c1-13-6-9-21(25-12-13)27-22(28)16-11-20(14-7-8-17(23)18(24)10-14)26-19-5-3-2-4-15(16)19/h2-12H,1H3,(H,25,27,28) |
| InChIKey | YBXMRMBLDALTFR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |