C20H11Cl2NO3 — CID 1177430
2-[5-(3,4-dichlorophenyl)furan-2-yl]quinoline-4-carboxylic acid (PubChem CID 1177430) has the molecular formula C20H11Cl2NO3 and a molecular weight of 384.22 g/mol. Its IUPAC name is 2-[5-(3,4-dichlorophenyl)furan-2-yl]quinoline-4-carboxylic acid.
| Compound Name | 2-[5-(3,4-dichlorophenyl)furan-2-yl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 1177430 |
| Molecular Formula | C20H11Cl2NO3 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 2-[5-(3,4-dichlorophenyl)furan-2-yl]quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(-c3ccc(Cl)c(Cl)c3)o2)nc2ccccc12 |
| InChI | InChI=1S/C20H11Cl2NO3/c21-14-6-5-11(9-15(14)22)18-7-8-19(26-18)17-10-13(20(24)25)12-3-1-2-4-16(12)23-17/h1-10H,(H,24,25) |
| InChIKey | RDBSBWUAEAZVJS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |