C19H16N2O4 — CID 135766643
[(2S)-1-amino-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate (PubChem CID 135766643) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 135766643 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(-c2ccc(O)cc2)nc2ccccc12)C(N)=O |
| InChI | InChI=1S/C19H16N2O4/c1-11(18(20)23)25-19(24)15-10-17(12-6-8-13(22)9-7-12)21-16-5-3-2-4-14(15)16/h2-11,22H,1H3,(H2,20,23)/t11-/m0/s1 |
| InChIKey | LCMXWDRVFNZEPQ-NSHDSACASA-N |
| XLogP | 2.64 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |