C21H20N2O4 — CID 135788920
[(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate (PubChem CID 135788920) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate.
| Compound Name | [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 135788920 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-(4-hydroxyphenyl)quinoline-4-carboxylate |
| SMILES | CCNC(=O)[C@H](C)OC(=O)c1cc(-c2ccc(O)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H20N2O4/c1-3-22-20(25)13(2)27-21(26)17-12-19(14-8-10-15(24)11-9-14)23-18-7-5-4-6-16(17)18/h4-13,24H,3H2,1-2H3,(H,22,25)/t13-/m0/s1 |
| InChIKey | VPPKJTNTYKOMPJ-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |