C25H16Cl4N2O4 — CID 2353485
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate (PubChem CID 2353485) has the molecular formula C25H16Cl4N2O4 and a molecular weight of 550.23 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2353485 |
| Molecular Formula | C25H16Cl4N2O4 |
| Molecular Weight | 550.23 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(-c3ccc(Cl)c(Cl)c3Cl)nc3ccccc23)cc1Cl |
| InChI | InChI=1S/C25H16Cl4N2O4/c1-34-21-9-6-13(10-18(21)27)30-22(32)12-35-25(33)16-11-20(31-19-5-3-2-4-14(16)19)15-7-8-17(26)24(29)23(15)28/h2-11H,12H2,1H3,(H,30,32) |
| InChIKey | ZICYTRNYGBDIIF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.23 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|