C27H15Cl3FN3O3S — CID 23880378
[2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate (PubChem CID 23880378) has the molecular formula C27H15Cl3FN3O3S and a molecular weight of 586.86 g/mol. Its IUPAC name is [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23880378 |
| Molecular Formula | C27H15Cl3FN3O3S |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 584.99 |
| IUPAC Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(Cl)c(Cl)c2Cl)nc2ccccc12)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C27H15Cl3FN3O3S/c28-19-10-9-17(24(29)25(19)30)21-11-18(16-3-1-2-4-20(16)32-21)26(36)37-12-23(35)34-27-33-22(13-38-27)14-5-7-15(31)8-6-14/h1-11,13H,12H2,(H,33,34,35) |
| InChIKey | WLUXEFLARHJTLP-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|