C18H12Cl2FN3O3S — CID 2095406
[2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 2095406) has the molecular formula C18H12Cl2FN3O3S and a molecular weight of 440.28 g/mol. Its IUPAC name is [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2095406 |
| Molecular Formula | C18H12Cl2FN3O3S |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | Nc1c(Cl)cc(Cl)cc1C(=O)OCC(=O)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C18H12Cl2FN3O3S/c19-10-5-12(16(22)13(20)6-10)17(26)27-7-15(25)24-18-23-14(8-28-18)9-1-3-11(21)4-2-9/h1-6,8H,7,22H2,(H,23,24,25) |
| InChIKey | HFLGLHYMUIIPKG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|