C18H12FIN2O3S — CID 2409334
[2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-iodobenzoate (PubChem CID 2409334) has the molecular formula C18H12FIN2O3S and a molecular weight of 482.27 g/mol. Its IUPAC name is [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-iodobenzoate.
| Compound Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-iodobenzoate |
|---|---|
| PubChem CID | 2409334 |
| Molecular Formula | C18H12FIN2O3S |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-iodobenzoate |
| SMILES | O=C(COC(=O)c1cccc(I)c1)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C18H12FIN2O3S/c19-13-6-4-11(5-7-13)15-10-26-18(21-15)22-16(23)9-25-17(24)12-2-1-3-14(20)8-12/h1-8,10H,9H2,(H,21,22,23) |
| InChIKey | GSWUXTGYQKPZSG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|