C29H24Cl3N3O5S — CID 4097494
[2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate (PubChem CID 4097494) has the molecular formula C29H24Cl3N3O5S and a molecular weight of 632.95 g/mol. Its IUPAC name is [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4097494 |
| Molecular Formula | C29H24Cl3N3O5S |
| Molecular Weight | 632.95 g/mol |
| Exact Mass | 631.05 |
| IUPAC Name | [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(Cl)c(Cl)c2Cl)nc2ccccc12)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C29H24Cl3N3O5S/c30-23-12-11-21(27(31)28(23)32)25-16-22(20-9-2-3-10-24(20)34-25)29(37)40-17-26(36)33-18-7-6-8-19(15-18)41(38,39)35-13-4-1-5-14-35/h2-3,6-12,15-16H,1,4-5,13-14,17H2,(H,33,36) |
| InChIKey | GVYGFHYCSDOOCZ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.95 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|