C24H19NO4 — CID 19101104
(2,6-dimethoxyphenyl) 2-phenylquinoline-4-carboxylate (PubChem CID 19101104) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 2-phenylquinoline-4-carboxylate.
| Compound Name | (2,6-dimethoxyphenyl) 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19101104 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (2,6-dimethoxyphenyl) 2-phenylquinoline-4-carboxylate |
| SMILES | COc1cccc(OC)c1OC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C24H19NO4/c1-27-21-13-8-14-22(28-2)23(21)29-24(26)18-15-20(16-9-4-3-5-10-16)25-19-12-7-6-11-17(18)19/h3-15H,1-2H3 |
| InChIKey | QKHQRVMYNJOVOV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|