C17H21N3O5 — CID 7977928
[2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate (PubChem CID 7977928) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7977928 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)OCC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H21N3O5/c1-11(25-13-7-5-12(9-18)6-8-13)15(22)24-10-14(21)19-16(23)20-17(2,3)4/h5-8,11H,10H2,1-4H3,(H2,19,20,21,23)/t11-/m1/s1 |
| InChIKey | GXGUIVJIFNNWKV-LLVKDONJSA-N |
| XLogP | 1.49 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |