C17H22N2O4 — CID 8855456
[(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate (PubChem CID 8855456) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 8855456 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@@H](OC(=O)[C@@H](C)Oc1ccc(C#N)cc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H22N2O4/c1-11(15(20)19-17(3,4)5)23-16(21)12(2)22-14-8-6-13(10-18)7-9-14/h6-9,11-12H,1-5H3,(H,19,20)/t11-,12-/m1/s1 |
| InChIKey | XZKYCDKEMWKPQJ-VXGBXAGGSA-N |
| XLogP | 2.17 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |