C15H17N3O5 — CID 8510608
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate (PubChem CID 8510608) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 8510608 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate |
| SMILES | CNC(=O)CNC(=O)COC(=O)[C@H](C)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H17N3O5/c1-10(23-12-5-3-11(7-16)4-6-12)15(21)22-9-14(20)18-8-13(19)17-2/h3-6,10H,8-9H2,1-2H3,(H,17,19)(H,18,20)/t10-/m0/s1 |
| InChIKey | LBGXSYSTNVBDMC-JTQLQIEISA-N |
| XLogP | -0.27 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |