C20H24N2O4 — CID 7978117
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate (PubChem CID 7978117) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7978117 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)OCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H24N2O4/c1-15(26-18-9-7-17(13-21)8-10-18)20(24)25-14-19(23)22-12-11-16-5-3-2-4-6-16/h5,7-10,15H,2-4,6,11-12,14H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | UUTKBKOXTUJQLF-OAHLLOKOSA-N |
| XLogP | 2.88 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|