C17H20N2O5 — CID 7984182
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-(4-cyanophenoxy)propanoate (PubChem CID 7984182) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7984182 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)OCC(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H20N2O5/c1-12(24-14-6-4-13(9-18)5-7-14)17(21)23-11-16(20)19-10-15-3-2-8-22-15/h4-7,12,15H,2-3,8,10-11H2,1H3,(H,19,20)/t12-,15-/m0/s1 |
| InChIKey | AOVIZNLPBSWROJ-WFASDCNBSA-N |
| XLogP | 1.16 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |