C15H20N2O5 — CID 8846660
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2R)-2-(3-methylphenoxy)propanoate (PubChem CID 8846660) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2R)-2-(3-methylphenoxy)propanoate.
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2R)-2-(3-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 8846660 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2R)-2-(3-methylphenoxy)propanoate |
| SMILES | CNC(=O)CNC(=O)COC(=O)[C@@H](C)Oc1cccc(C)c1 |
| InChI | InChI=1S/C15H20N2O5/c1-10-5-4-6-12(7-10)22-11(2)15(20)21-9-14(19)17-8-13(18)16-3/h4-7,11H,8-9H2,1-3H3,(H,16,18)(H,17,19)/t11-/m1/s1 |
| InChIKey | XHWOPQSNHILRDW-LLVKDONJSA-N |
| XLogP | 0.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |