C18H17N3O5 — CID 7804473
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804473) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804473 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | C[C@](C#N)(NC(=O)COC(=O)CN1C(=O)C(=O)c2ccccc21)C1CC1 |
| InChI | InChI=1S/C18H17N3O5/c1-18(10-19,11-6-7-11)20-14(22)9-26-15(23)8-21-13-5-3-2-4-12(13)16(24)17(21)25/h2-5,11H,6-9H2,1H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | DZOIGZRCVICWQH-GOSISDBHSA-N |
| XLogP | 0.57 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|