C17H20N2O5S — CID 8857232
[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-ethylsulfonylbenzoate (PubChem CID 8857232) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-ethylsulfonylbenzoate.
| Compound Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8857232 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)N[C@@](C)(C#N)C1CC1 |
| InChI | InChI=1S/C17H20N2O5S/c1-3-25(22,23)14-7-5-4-6-13(14)16(21)24-10-15(20)19-17(2,11-18)12-8-9-12/h4-7,12H,3,8-10H2,1-2H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | JMJJXEBYJLMBJJ-KRWDZBQOSA-N |
| XLogP | 1.45 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |