C17H32N4O4S — CID 128943193
4-[cyclohexyl(methyl)sulfamoyl]-N-(oxan-4-yl)piperazine-1-carboxamide (PubChem CID 128943193) has the molecular formula C17H32N4O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)sulfamoyl]-N-(oxan-4-yl)piperazine-1-carboxamide.
| Compound Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-(oxan-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 128943193 |
| Molecular Formula | C17H32N4O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-(oxan-4-yl)piperazine-1-carboxamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(C(=O)NC2CCOCC2)CC1 |
| InChI | InChI=1S/C17H32N4O4S/c1-19(16-5-3-2-4-6-16)26(23,24)21-11-9-20(10-12-21)17(22)18-15-7-13-25-14-8-15/h15-16H,2-14H2,1H3,(H,18,22) |
| InChIKey | GCQMJMSEGQLYRX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |