C27H35N3O4S — CID 32769750
N-cyclohexyl-3-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-N-methylbenzenesulfonamide (PubChem CID 32769750) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-cyclohexyl-3-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-N-methylbenzenesulfonamide.
| Compound Name | N-cyclohexyl-3-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 32769750 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-cyclohexyl-3-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-N-methylbenzenesulfonamide |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)c3cccc(S(=O)(=O)N(C)C4CCCCC4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H35N3O4S/c1-3-21-12-14-22(15-13-21)26(31)29-16-18-30(19-17-29)27(32)23-8-7-11-25(20-23)35(33,34)28(2)24-9-5-4-6-10-24/h7-8,11-15,20,24H,3-6,9-10,16-19H2,1-2H3 |
| InChIKey | MXJYOPDWRCWEII-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |