C16H22N2O3S2 — CID 77083695
3-(azetidine-1-carbonyl)-N-methyl-N-(thian-4-yl)benzenesulfonamide (PubChem CID 77083695) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 3-(azetidine-1-carbonyl)-N-methyl-N-(thian-4-yl)benzenesulfonamide.
| Compound Name | 3-(azetidine-1-carbonyl)-N-methyl-N-(thian-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 77083695 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-(azetidine-1-carbonyl)-N-methyl-N-(thian-4-yl)benzenesulfonamide |
| SMILES | CN(C1CCSCC1)S(=O)(=O)c1cccc(C(=O)N2CCC2)c1 |
| InChI | InChI=1S/C16H22N2O3S2/c1-17(14-6-10-22-11-7-14)23(20,21)15-5-2-4-13(12-15)16(19)18-8-3-9-18/h2,4-5,12,14H,3,6-11H2,1H3 |
| InChIKey | VRGLKMANWMMUMM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |