C22H22Br6N2O6S2 — CID 91282394
N,N-dimethyl-3-(tribromomethylsulfonyl)benzamide;pyrrolidin-1-yl-[3-(tribromomethylsulfonyl)phenyl]methanone (PubChem CID 91282394) has the molecular formula C22H22Br6N2O6S2 and a molecular weight of 953.98 g/mol. Its IUPAC name is N,N-dimethyl-3-(tribromomethylsulfonyl)benzamide;pyrrolidin-1-yl-[3-(tribromomethylsulfonyl)phenyl]methanone.
| Compound Name | N,N-dimethyl-3-(tribromomethylsulfonyl)benzamide;pyrrolidin-1-yl-[3-(tribromomethylsulfonyl)phenyl]methanone |
|---|---|
| PubChem CID | 91282394 |
| Molecular Formula | C22H22Br6N2O6S2 |
| Molecular Weight | 953.98 g/mol |
| Exact Mass | 947.60 |
| IUPAC Name | N,N-dimethyl-3-(tribromomethylsulfonyl)benzamide;pyrrolidin-1-yl-[3-(tribromomethylsulfonyl)phenyl]methanone |
| SMILES | CN(C)C(=O)c1cccc(S(=O)(=O)C(Br)(Br)Br)c1.O=C(c1cccc(S(=O)(=O)C(Br)(Br)Br)c1)N1CCCC1 |
| InChI | InChI=1S/C12H12Br3NO3S.C10H10Br3NO3S/c13-12(14,15)20(18,19)10-5-3-4-9(8-10)11(17)16-6-1-2-7-16;1-14(2)9(15)7-4-3-5-8(6-7)18(16,17)10(11,12)13/h3-5,8H,1-2,6-7H2;3-6H,1-2H3 |
| InChIKey | UEXGLLWGPYIHGN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.98 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|