C23H31N3O3S2 — CID 55599951
N-cyclohexyl-N-methyl-4-[3-(4-methylphenyl)thiophene-2-carbonyl]piperazine-1-sulfonamide (PubChem CID 55599951) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[3-(4-methylphenyl)thiophene-2-carbonyl]piperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[3-(4-methylphenyl)thiophene-2-carbonyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55599951 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[3-(4-methylphenyl)thiophene-2-carbonyl]piperazine-1-sulfonamide |
| SMILES | Cc1ccc(-c2ccsc2C(=O)N2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O3S2/c1-18-8-10-19(11-9-18)21-12-17-30-22(21)23(27)25-13-15-26(16-14-25)31(28,29)24(2)20-6-4-3-5-7-20/h8-12,17,20H,3-7,13-16H2,1-2H3 |
| InChIKey | XNOXMCGCHVNEPT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |