C25H28N2O4 — CID 26199089
propyl 4-[[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]benzoate (PubChem CID 26199089) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is propyl 4-[[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]benzoate.
| Compound Name | propyl 4-[[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 26199089 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | propyl 4-[[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)C2CCN(C(=O)/C=C/c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-2-18-31-25(30)21-9-11-22(12-10-21)26-24(29)20-14-16-27(17-15-20)23(28)13-8-19-6-4-3-5-7-19/h3-13,20H,2,14-18H2,1H3,(H,26,29)/b13-8+ |
| InChIKey | RQJUSXKNXTXNPA-MDWZMJQESA-N |
| XLogP | 4.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|