C14H21N3O4S — CID 94068233
(2S)-2-methylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]propanamide (PubChem CID 94068233) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is (2S)-2-methylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]propanamide.
| Compound Name | (2S)-2-methylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]propanamide |
|---|---|
| PubChem CID | 94068233 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2S)-2-methylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccnc(N2CCOCC2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H21N3O4S/c1-11(22(2,19)20)14(18)16-10-12-3-4-15-13(9-12)17-5-7-21-8-6-17/h3-4,9,11H,5-8,10H2,1-2H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | NHRGACJJPGGWAU-NSHDSACASA-N |
| XLogP | -0.03 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |