C17H22N4O2S — CID 36974773
1-[(2-morpholin-4-yl-4-pyridinyl)methyl]-3-[(1R)-1-thiophen-2-ylethyl]urea (PubChem CID 36974773) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[(2-morpholin-4-yl-4-pyridinyl)methyl]-3-[(1R)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-[(2-morpholin-4-yl-4-pyridinyl)methyl]-3-[(1R)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 36974773 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[(2-morpholin-4-yl-4-pyridinyl)methyl]-3-[(1R)-1-thiophen-2-ylethyl]urea |
| SMILES | C[C@@H](NC(=O)NCc1ccnc(N2CCOCC2)c1)c1cccs1 |
| InChI | InChI=1S/C17H22N4O2S/c1-13(15-3-2-10-24-15)20-17(22)19-12-14-4-5-18-16(11-14)21-6-8-23-9-7-21/h2-5,10-11,13H,6-9,12H2,1H3,(H2,19,20,22)/t13-/m1/s1 |
| InChIKey | WHAMAWWKWJWFNK-CYBMUJFWSA-N |
| XLogP | 2.54 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |