C22H29N5O3 — CID 55698495
3-methyl-N-[4-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]butanamide (PubChem CID 55698495) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-methyl-N-[4-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]butanamide |
|---|---|
| PubChem CID | 55698495 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-methyl-N-[4-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)NCc2ccnc(N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C22H29N5O3/c1-16(2)13-21(28)25-18-3-5-19(6-4-18)26-22(29)24-15-17-7-8-23-20(14-17)27-9-11-30-12-10-27/h3-8,14,16H,9-13,15H2,1-2H3,(H,25,28)(H2,24,26,29) |
| InChIKey | NEQPSIOOHIWCGR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |