C20H25N5O3 — CID 55745131
N-[2-methyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]acetamide (PubChem CID 55745131) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[2-methyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[2-methyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 55745131 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[2-methyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC(=O)NCc2ccnc(N3CCOCC3)c2)ccc1C |
| InChI | InChI=1S/C20H25N5O3/c1-14-3-4-17(12-18(14)23-15(2)26)24-20(27)22-13-16-5-6-21-19(11-16)25-7-9-28-10-8-25/h3-6,11-12H,7-10,13H2,1-2H3,(H,23,26)(H2,22,24,27) |
| InChIKey | MLZZDWNRZUBYBG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |