C23H29N5O4 — CID 55743484
1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea (PubChem CID 55743484) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55743484 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea |
| SMILES | COc1ccc(NC(=O)NCc2ccnc(N3CCOCC3)c2)cc1N1CCCCC1=O |
| InChI | InChI=1S/C23H29N5O4/c1-31-20-6-5-18(15-19(20)28-9-3-2-4-22(28)29)26-23(30)25-16-17-7-8-24-21(14-17)27-10-12-32-13-11-27/h5-8,14-15H,2-4,9-13,16H2,1H3,(H2,25,26,30) |
| InChIKey | MEISNLOURLONEH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |