C23H29N3O4 — CID 55820823
1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(3-propan-2-yloxyphenyl)methyl]urea (PubChem CID 55820823) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(3-propan-2-yloxyphenyl)methyl]urea.
| Compound Name | 1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(3-propan-2-yloxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 55820823 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-3-[(3-propan-2-yloxyphenyl)methyl]urea |
| SMILES | COc1ccc(NC(=O)NCc2cccc(OC(C)C)c2)cc1N1CCCCC1=O |
| InChI | InChI=1S/C23H29N3O4/c1-16(2)30-19-8-6-7-17(13-19)15-24-23(28)25-18-10-11-21(29-3)20(14-18)26-12-5-4-9-22(26)27/h6-8,10-11,13-14,16H,4-5,9,12,15H2,1-3H3,(H2,24,25,28) |
| InChIKey | OBJJLYGVTQLHPM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |