C17H26N4O3 — CID 32584933
(2S)-2-acetamido-3-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide (PubChem CID 32584933) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2S)-2-acetamido-3-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide.
| Compound Name | (2S)-2-acetamido-3-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 32584933 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (2S)-2-acetamido-3-methyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide |
| SMILES | CC(=O)N[C@H](C(=O)NCc1ccnc(N2CCOCC2)c1)C(C)C |
| InChI | InChI=1S/C17H26N4O3/c1-12(2)16(20-13(3)22)17(23)19-11-14-4-5-18-15(10-14)21-6-8-24-9-7-21/h4-5,10,12,16H,6-9,11H2,1-3H3,(H,19,23)(H,20,22)/t16-/m0/s1 |
| InChIKey | HUWLTARRRFCIKC-INIZCTEOSA-N |
| XLogP | 0.70 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |