C21H32N4O2 — CID 119879430
2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]-1-(4-ethylpiperazin-1-yl)ethanone (PubChem CID 119879430) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]-1-(4-ethylpiperazin-1-yl)ethanone.
| Compound Name | 2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]-1-(4-ethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 119879430 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]-1-(4-ethylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCN(C(=O)CC2CCN(C(=O)Cc3ccc(N)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H32N4O2/c1-2-23-11-13-25(14-12-23)21(27)16-18-7-9-24(10-8-18)20(26)15-17-3-5-19(22)6-4-17/h3-6,18H,2,7-16,22H2,1H3 |
| InChIKey | FBUXZSDHFQDMHS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|