C15H21N3O2 — CID 60964094
2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]acetamide (PubChem CID 60964094) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 60964094 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-[1-[2-(4-aminophenyl)acetyl]piperidin-4-yl]acetamide |
| SMILES | NC(=O)CC1CCN(C(=O)Cc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C15H21N3O2/c16-13-3-1-11(2-4-13)10-15(20)18-7-5-12(6-8-18)9-14(17)19/h1-4,12H,5-10,16H2,(H2,17,19) |
| InChIKey | APPOTMGUWOVKBX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|