C11H17F2NO2 — CID 130457668
1-(4,4-difluoropiperidin-1-yl)-3-methylpentane-1,2-dione (PubChem CID 130457668) has the molecular formula C11H17F2NO2 and a molecular weight of 233.26 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-3-methylpentane-1,2-dione.
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-3-methylpentane-1,2-dione |
|---|---|
| PubChem CID | 130457668 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-3-methylpentane-1,2-dione |
| SMILES | CCC(C)C(=O)C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H17F2NO2/c1-3-8(2)9(15)10(16)14-6-4-11(12,13)5-7-14/h8H,3-7H2,1-2H3 |
| InChIKey | ITDSBUNBNDPTRZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|