About 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one
3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 116991070) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 116991070 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CN)C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H18F2N2O/c1-9(2,7-13)8(15)14-5-3-10(11,12)4-6-14/h3-7,13H2,1-2H3 |
| InChIKey | MLWSWIZUJPYDPX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one (CID 116991070) is 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one is CC(C)(CN)C(=O)N1CCC(F)(F)CC1.
What is the InChIKey of 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one?
The InChIKey is MLWSWIZUJPYDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-9(2,7-13)8(15)14-5-3-10(11,12)4-6-14/h3-7,13H2,1-2H3.
What are the key properties of 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one?
3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one has a molecular weight of 220.26 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 116991070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).