C11H16F4N2O — CID 140517091
bis(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 140517091) has the molecular formula C11H16F4N2O and a molecular weight of 268.25 g/mol. Its IUPAC name is bis(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | bis(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 140517091 |
| Molecular Formula | C11H16F4N2O |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | bis(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | O=C(N1CCC(F)(F)CC1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H16F4N2O/c12-10(13)1-5-16(6-2-10)9(18)17-7-3-11(14,15)4-8-17/h1-8H2 |
| InChIKey | HOHRXYCEVFIKDU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |